C34H37N3O3S — CID 50862746
4-[[(5E)-4-oxo-2-phenylimino-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-3-yl]methyl]benzoic acid (PubChem CID 50862746) has the molecular formula C34H37N3O3S and a molecular weight of 567.76 g/mol. Its IUPAC name is 4-[[(5E)-4-oxo-2-phenylimino-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-3-yl]methyl]benzoic acid.
| Compound Name | 4-[[(5E)-4-oxo-2-phenylimino-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 50862746 |
| Molecular Formula | C34H37N3O3S |
| Molecular Weight | 567.76 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | 4-[[(5E)-4-oxo-2-phenylimino-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-3-yl]methyl]benzoic acid |
| SMILES | CCCN1c2cc(C)c(/C=C3/S/C(=N\c4ccccc4)N(Cc4ccc(C(=O)O)cc4)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C34H37N3O3S/c1-6-16-37-29-17-22(2)26(18-28(29)23(3)20-34(37,4)5)19-30-31(38)36(21-24-12-14-25(15-13-24)32(39)40)33(41-30)35-27-10-8-7-9-11-27/h7-15,17-19,23H,6,16,20-21H2,1-5H3,(H,39,40)/b30-19+,35-33- |
| InChIKey | RVEWIUOVDIMFIY-NEUGOIOMSA-N |
| XLogP | 8.00 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.76 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|