C27H32ClN3OS — CID 50863184
(5E)-5-[(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-3-ethyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 50863184) has the molecular formula C27H32ClN3OS and a molecular weight of 482.09 g/mol. Its IUPAC name is (5E)-5-[(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-3-ethyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-3-ethyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50863184 |
| Molecular Formula | C27H32ClN3OS |
| Molecular Weight | 482.09 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | (5E)-5-[(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-3-ethyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | CCCN1c2cc(Cl)c(/C=C3/S/C(=N\c4ccccc4)N(CC)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C27H32ClN3OS/c1-6-13-31-23-16-22(28)19(14-21(23)18(3)17-27(31,4)5)15-24-25(32)30(7-2)26(33-24)29-20-11-9-8-10-12-20/h8-12,14-16,18H,6-7,13,17H2,1-5H3/b24-15+,29-26- |
| InChIKey | VTMAYIKQHOIEMM-MBSDTRKCSA-N |
| XLogP | 7.47 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.09 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|