C25H28ClN3OS — CID 132675409
(5Z)-5-[(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-3-ethyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 132675409) has the molecular formula C25H28ClN3OS and a molecular weight of 454.04 g/mol. Its IUPAC name is (5Z)-5-[(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-3-ethyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-3-ethyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 132675409 |
| Molecular Formula | C25H28ClN3OS |
| Molecular Weight | 454.04 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | (5Z)-5-[(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-3-ethyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C/c2cc3c(cc2Cl)N(C)C(C)(C)CC3C)S/C1=N/c1ccccc1 |
| InChI | InChI=1S/C25H28ClN3OS/c1-6-29-23(30)22(31-24(29)27-18-10-8-7-9-11-18)13-17-12-19-16(2)15-25(3,4)28(5)21(19)14-20(17)26/h7-14,16H,6,15H2,1-5H3/b22-13-,27-24+ |
| InChIKey | JTHCOAVSFVINFJ-NOPZMTQPSA-N |
| XLogP | 6.69 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.04 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|