C29H28ClN3OS — CID 50858938
(5E)-5-[(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 50858938) has the molecular formula C29H28ClN3OS and a molecular weight of 502.08 g/mol. Its IUPAC name is (5E)-5-[(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50858938 |
| Molecular Formula | C29H28ClN3OS |
| Molecular Weight | 502.08 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | (5E)-5-[(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | CC1CC(C)(C)N(C)c2cc(Cl)c(/C=C3/S/C(=N\c4ccccc4)N(c4ccccc4)C3=O)cc21 |
| InChI | InChI=1S/C29H28ClN3OS/c1-19-18-29(2,3)32(4)25-17-24(30)20(15-23(19)25)16-26-27(34)33(22-13-9-6-10-14-22)28(35-26)31-21-11-7-5-8-12-21/h5-17,19H,18H2,1-4H3/b26-16+,31-28- |
| InChIKey | UPXFNLZRPZLULA-HSJZEISMSA-N |
| XLogP | 7.87 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.08 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|