C28H33ClN4O2S — CID 125043842
(5Z)-5-[[(4S)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-3-methyl-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 125043842) has the molecular formula C28H33ClN4O2S and a molecular weight of 525.12 g/mol. Its IUPAC name is (5Z)-5-[[(4S)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-3-methyl-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[(4S)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-3-methyl-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 125043842 |
| Molecular Formula | C28H33ClN4O2S |
| Molecular Weight | 525.12 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | (5Z)-5-[[(4S)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-3-methyl-2-(4-morpholin-4-ylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | C[C@H]1CC(C)(C)N(C)c2cc(Cl)c(/C=C3\S/C(=N/c4ccc(N5CCOCC5)cc4)N(C)C3=O)cc21 |
| InChI | InChI=1S/C28H33ClN4O2S/c1-18-17-28(2,3)32(5)24-16-23(29)19(14-22(18)24)15-25-26(34)31(4)27(36-25)30-20-6-8-21(9-7-20)33-10-12-35-13-11-33/h6-9,14-16,18H,10-13,17H2,1-5H3/b25-15-,30-27+/t18-/m0/s1 |
| InChIKey | YZMCFZOHZXCYDM-FIGSSCJLSA-N |
| XLogP | 6.13 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.12 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|