C23H23BrClN3OS — CID 136831765
(5Z)-2-(4-bromophenyl)imino-5-[[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 136831765) has the molecular formula C23H23BrClN3OS and a molecular weight of 504.88 g/mol. Its IUPAC name is (5Z)-2-(4-bromophenyl)imino-5-[[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-bromophenyl)imino-5-[[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136831765 |
| Molecular Formula | C23H23BrClN3OS |
| Molecular Weight | 504.88 g/mol |
| Exact Mass | 503.04 |
| IUPAC Name | (5Z)-2-(4-bromophenyl)imino-5-[[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | C[C@@H]1CC(C)(C)N(C)c2cc(Cl)c(/C=C3\S/C(=N/c4ccc(Br)cc4)NC3=O)cc21 |
| InChI | InChI=1S/C23H23BrClN3OS/c1-13-12-23(2,3)28(4)19-11-18(25)14(9-17(13)19)10-20-21(29)27-22(30-20)26-16-7-5-15(24)6-8-16/h5-11,13H,12H2,1-4H3,(H,26,27,29)/b20-10-/t13-/m1/s1 |
| InChIKey | MTKFGARYUCWCQB-CFFVULROSA-N |
| XLogP | 6.72 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.88 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|