C24H23BrClN3O3 — CID 99886207
(5E)-1-(4-bromophenyl)-5-[[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 99886207) has the molecular formula C24H23BrClN3O3 and a molecular weight of 516.82 g/mol. Its IUPAC name is (5E)-1-(4-bromophenyl)-5-[[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(4-bromophenyl)-5-[[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 99886207 |
| Molecular Formula | C24H23BrClN3O3 |
| Molecular Weight | 516.82 g/mol |
| Exact Mass | 515.06 |
| IUPAC Name | (5E)-1-(4-bromophenyl)-5-[[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | C[C@@H]1CC(C)(C)N(C)c2cc(Cl)c(/C=C3\C(=O)NC(=O)N(c4ccc(Br)cc4)C3=O)cc21 |
| InChI | InChI=1S/C24H23BrClN3O3/c1-13-12-24(2,3)28(4)20-11-19(26)14(9-17(13)20)10-18-21(30)27-23(32)29(22(18)31)16-7-5-15(25)6-8-16/h5-11,13H,12H2,1-4H3,(H,27,30,32)/b18-10+/t13-/m1/s1 |
| InChIKey | CYLRILAFXYXQRF-HVOBPNNYSA-N |
| XLogP | 5.49 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.82 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|