C24H22Cl3N3O3 — CID 99886261
(5E)-5-[[(4S)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1-(2,3-dichlorophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 99886261) has the molecular formula C24H22Cl3N3O3 and a molecular weight of 506.82 g/mol. Its IUPAC name is (5E)-5-[[(4S)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1-(2,3-dichlorophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[(4S)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1-(2,3-dichlorophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 99886261 |
| Molecular Formula | C24H22Cl3N3O3 |
| Molecular Weight | 506.82 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | (5E)-5-[[(4S)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1-(2,3-dichlorophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | C[C@H]1CC(C)(C)N(C)c2cc(Cl)c(/C=C3\C(=O)NC(=O)N(c4cccc(Cl)c4Cl)C3=O)cc21 |
| InChI | InChI=1S/C24H22Cl3N3O3/c1-12-11-24(2,3)29(4)19-10-17(26)13(8-14(12)19)9-15-21(31)28-23(33)30(22(15)32)18-7-5-6-16(25)20(18)27/h5-10,12H,11H2,1-4H3,(H,28,31,33)/b15-9+/t12-/m0/s1 |
| InChIKey | RAIABIOOYSQSEJ-DGGAMASNSA-N |
| XLogP | 6.04 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.82 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|