C26H28ClN3O4 — CID 125043832
(5E)-5-[[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1-(3-ethoxyphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 125043832) has the molecular formula C26H28ClN3O4 and a molecular weight of 481.98 g/mol. Its IUPAC name is (5E)-5-[[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1-(3-ethoxyphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1-(3-ethoxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 125043832 |
| Molecular Formula | C26H28ClN3O4 |
| Molecular Weight | 481.98 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | (5E)-5-[[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1-(3-ethoxyphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1cccc(N2C(=O)NC(=O)/C(=C\c3cc4c(cc3Cl)N(C)C(C)(C)C[C@H]4C)C2=O)c1 |
| InChI | InChI=1S/C26H28ClN3O4/c1-6-34-18-9-7-8-17(12-18)30-24(32)20(23(31)28-25(30)33)11-16-10-19-15(2)14-26(3,4)29(5)22(19)13-21(16)27/h7-13,15H,6,14H2,1-5H3,(H,28,31,33)/b20-11+/t15-/m1/s1 |
| InChIKey | YOLCMRJRKCUWSO-PZUDMAOCSA-N |
| XLogP | 5.13 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.98 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|