C27H30ClN3O4 — CID 50861061
(5Z)-5-[(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-1-(3-ethoxyphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 50861061) has the molecular formula C27H30ClN3O4 and a molecular weight of 496.01 g/mol. Its IUPAC name is (5Z)-5-[(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-1-(3-ethoxyphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-5-[(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-1-(3-ethoxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 50861061 |
| Molecular Formula | C27H30ClN3O4 |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | (5Z)-5-[(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-1-(3-ethoxyphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1cccc(N2C(=O)NC(=O)/C(=C/c3cc4c(cc3Cl)N(CC)C(C)(C)CC4C)C2=O)c1 |
| InChI | InChI=1S/C27H30ClN3O4/c1-6-30-23-14-22(28)17(11-20(23)16(3)15-27(30,4)5)12-21-24(32)29-26(34)31(25(21)33)18-9-8-10-19(13-18)35-7-2/h8-14,16H,6-7,15H2,1-5H3,(H,29,32,34)/b21-12- |
| InChIKey | INMQHRHEQWEGEO-MTJSOVHGSA-N |
| XLogP | 5.52 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|