C25H26FN3O3 — CID 124648981
(5E)-5-[[(4R)-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl]methylidene]-1-(3-fluorophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 124648981) has the molecular formula C25H26FN3O3 and a molecular weight of 435.50 g/mol. Its IUPAC name is (5E)-5-[[(4R)-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl]methylidene]-1-(3-fluorophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[(4R)-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl]methylidene]-1-(3-fluorophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 124648981 |
| Molecular Formula | C25H26FN3O3 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | (5E)-5-[[(4R)-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl]methylidene]-1-(3-fluorophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCN1c2ccc(/C=C3\C(=O)NC(=O)N(c4cccc(F)c4)C3=O)cc2[C@H](C)CC1(C)C |
| InChI | InChI=1S/C25H26FN3O3/c1-5-28-21-10-9-16(11-19(21)15(2)14-25(28,3)4)12-20-22(30)27-24(32)29(23(20)31)18-8-6-7-17(26)13-18/h6-13,15H,5,14H2,1-4H3,(H,27,30,32)/b20-12+/t15-/m1/s1 |
| InChIKey | GYNXPGDRRCGGLQ-RVZJCZPVSA-N |
| XLogP | 4.60 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|