C28H32ClN3O3 — CID 50863037
(5Z)-5-[(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1-(4-ethylphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 50863037) has the molecular formula C28H32ClN3O3 and a molecular weight of 494.04 g/mol. Its IUPAC name is (5Z)-5-[(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1-(4-ethylphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-5-[(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1-(4-ethylphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 50863037 |
| Molecular Formula | C28H32ClN3O3 |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | (5Z)-5-[(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1-(4-ethylphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCCN1c2cc(Cl)c(/C=C3/C(=O)NC(=O)N(c4ccc(CC)cc4)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C28H32ClN3O3/c1-6-12-31-24-15-23(29)19(13-21(24)17(3)16-28(31,4)5)14-22-25(33)30-27(35)32(26(22)34)20-10-8-18(7-2)9-11-20/h8-11,13-15,17H,6-7,12,16H2,1-5H3,(H,30,33,35)/b22-14- |
| InChIKey | ZVHCKVYUVHDYMM-HMAPJEAMSA-N |
| XLogP | 6.07 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|