C37H45N3O3 — CID 50860976
(5Z)-1-[4-(1-adamantyl)phenyl]-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 50860976) has the molecular formula C37H45N3O3 and a molecular weight of 579.79 g/mol. Its IUPAC name is (5Z)-1-[4-(1-adamantyl)phenyl]-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-[4-(1-adamantyl)phenyl]-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 50860976 |
| Molecular Formula | C37H45N3O3 |
| Molecular Weight | 579.79 g/mol |
| Exact Mass | 579.35 |
| IUPAC Name | (5Z)-1-[4-(1-adamantyl)phenyl]-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCN1c2cc(C)c(/C=C3/C(=O)NC(=O)N(c4ccc(C56CC7CC(CC(C7)C5)C6)cc4)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C37H45N3O3/c1-6-11-39-32-12-22(2)27(16-30(32)23(3)18-36(39,4)5)17-31-33(41)38-35(43)40(34(31)42)29-9-7-28(8-10-29)37-19-24-13-25(20-37)15-26(14-24)21-37/h7-10,12,16-17,23-26H,6,11,13-15,18-21H2,1-5H3,(H,38,41,43)/b31-17- |
| InChIKey | QWVSHQQCDNNKEQ-LJUMEUDFSA-N |
| XLogP | 7.63 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.79 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|