C19H22ClN3O2S — CID 99886429
(5E)-5-[[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1-methyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 99886429) has the molecular formula C19H22ClN3O2S and a molecular weight of 391.92 g/mol. Its IUPAC name is (5E)-5-[[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1-methyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-5-[[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1-methyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 99886429 |
| Molecular Formula | C19H22ClN3O2S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (5E)-5-[[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1-methyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | C[C@@H]1CC(C)(C)N(C)c2cc(Cl)c(/C=C3\C(=O)NC(=S)N(C)C3=O)cc21 |
| InChI | InChI=1S/C19H22ClN3O2S/c1-10-9-19(2,3)23(5)15-8-14(20)11(6-12(10)15)7-13-16(24)21-18(26)22(4)17(13)25/h6-8,10H,9H2,1-5H3,(H,21,24,26)/b13-7+/t10-/m1/s1 |
| InChIKey | BOYCJEBELILSAJ-SRMXYGTFSA-N |
| XLogP | 3.32 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|