C25H25BrClN3O3S — CID 99886574
N-(4-bromophenyl)-2-[(5Z)-5-[[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 99886574) has the molecular formula C25H25BrClN3O3S and a molecular weight of 562.92 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[(5Z)-5-[[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[(5Z)-5-[[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 99886574 |
| Molecular Formula | C25H25BrClN3O3S |
| Molecular Weight | 562.92 g/mol |
| Exact Mass | 561.05 |
| IUPAC Name | N-(4-bromophenyl)-2-[(5Z)-5-[[(4R)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | C[C@@H]1CC(C)(C)N(C)c2cc(Cl)c(/C=C3\SC(=O)N(CC(=O)Nc4ccc(Br)cc4)C3=O)cc21 |
| InChI | InChI=1S/C25H25BrClN3O3S/c1-14-12-25(2,3)29(4)20-11-19(27)15(9-18(14)20)10-21-23(32)30(24(33)34-21)13-22(31)28-17-7-5-16(26)6-8-17/h5-11,14H,12-13H2,1-4H3,(H,28,31)/b21-10-/t14-/m1/s1 |
| InChIKey | ARBRHYXHNCXIQX-YYLUKMIBSA-N |
| XLogP | 6.50 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.92 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|