C26H28ClN3O3S — CID 132679727
2-[(5Z)-5-[(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methylphenyl)acetamide (PubChem CID 132679727) has the molecular formula C26H28ClN3O3S and a molecular weight of 498.05 g/mol. Its IUPAC name is 2-[(5Z)-5-[(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 132679727 |
| Molecular Formula | C26H28ClN3O3S |
| Molecular Weight | 498.05 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 2-[(5Z)-5-[(7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)S/C(=C\c3cc4c(cc3Cl)N(C)C(C)(C)CC4C)C2=O)cc1 |
| InChI | InChI=1S/C26H28ClN3O3S/c1-15-6-8-18(9-7-15)28-23(31)14-30-24(32)22(34-25(30)33)11-17-10-19-16(2)13-26(3,4)29(5)21(19)12-20(17)27/h6-12,16H,13-14H2,1-5H3,(H,28,31)/b22-11- |
| InChIKey | ZCGAVROJRIDPSD-JJFYIABZSA-N |
| XLogP | 6.05 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.05 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|