C26H29ClN4O3 — CID 50858668
N-(4-chlorophenyl)-2-[(4E)-2,5-dioxo-4-[(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylidene]imidazolidin-1-yl]acetamide (PubChem CID 50858668) has the molecular formula C26H29ClN4O3 and a molecular weight of 481.00 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(4E)-2,5-dioxo-4-[(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylidene]imidazolidin-1-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(4E)-2,5-dioxo-4-[(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylidene]imidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 50858668 |
| Molecular Formula | C26H29ClN4O3 |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(4E)-2,5-dioxo-4-[(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylidene]imidazolidin-1-yl]acetamide |
| SMILES | Cc1cc2c(cc1/C=C1/NC(=O)N(CC(=O)Nc3ccc(Cl)cc3)C1=O)C(C)CC(C)(C)N2C |
| InChI | InChI=1S/C26H29ClN4O3/c1-15-10-22-20(16(2)13-26(3,4)30(22)5)11-17(15)12-21-24(33)31(25(34)29-21)14-23(32)28-19-8-6-18(27)7-9-19/h6-12,16H,13-14H2,1-5H3,(H,28,32)(H,29,34)/b21-12+ |
| InChIKey | IUCYXCTYFXRJGD-CIAFOILYSA-N |
| XLogP | 4.90 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|