C26H29BrN4O4 — CID 50859945
N-(4-bromophenyl)-2-[(4E)-4-[(7-methoxy-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 50859945) has the molecular formula C26H29BrN4O4 and a molecular weight of 541.45 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[(4E)-4-[(7-methoxy-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[(4E)-4-[(7-methoxy-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 50859945 |
| Molecular Formula | C26H29BrN4O4 |
| Molecular Weight | 541.45 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | N-(4-bromophenyl)-2-[(4E)-4-[(7-methoxy-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | COc1cc2c(cc1/C=C1/NC(=O)N(CC(=O)Nc3ccc(Br)cc3)C1=O)C(C)CC(C)(C)N2C |
| InChI | InChI=1S/C26H29BrN4O4/c1-15-13-26(2,3)30(4)21-12-22(35-5)16(10-19(15)21)11-20-24(33)31(25(34)29-20)14-23(32)28-18-8-6-17(27)7-9-18/h6-12,15H,13-14H2,1-5H3,(H,28,32)(H,29,34)/b20-11+ |
| InChIKey | IPXWTUGZJNORFL-RGVLZGJSSA-N |
| XLogP | 4.71 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|