C29H36N4O5 — CID 50864046
N-(4-methoxyphenyl)-2-[(4E)-4-[(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 50864046) has the molecular formula C29H36N4O5 and a molecular weight of 520.63 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[(4E)-4-[(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(4-methoxyphenyl)-2-[(4E)-4-[(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 50864046 |
| Molecular Formula | C29H36N4O5 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[(4E)-4-[(7-methoxy-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CCCN1c2cc(OC)c(/C=C3/NC(=O)N(CC(=O)Nc4ccc(OC)cc4)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C29H36N4O5/c1-7-12-33-24-15-25(38-6)19(13-22(24)18(2)16-29(33,3)4)14-23-27(35)32(28(36)31-23)17-26(34)30-20-8-10-21(37-5)11-9-20/h8-11,13-15,18H,7,12,16-17H2,1-6H3,(H,30,34)(H,31,36)/b23-14+ |
| InChIKey | IADVDAKALBCYLV-OEAKJJBVSA-N |
| XLogP | 4.74 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|