C27H31FN4O4 — CID 50861986
2-[(4E)-4-[(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 50861986) has the molecular formula C27H31FN4O4 and a molecular weight of 494.57 g/mol. Its IUPAC name is 2-[(4E)-4-[(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[(4E)-4-[(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 50861986 |
| Molecular Formula | C27H31FN4O4 |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 2-[(4E)-4-[(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | CCN1c2cc(OC)c(/C=C3/NC(=O)N(CC(=O)Nc4ccc(F)cc4)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C27H31FN4O4/c1-6-32-22-13-23(36-5)17(11-20(22)16(2)14-27(32,3)4)12-21-25(34)31(26(35)30-21)15-24(33)29-19-9-7-18(28)8-10-19/h7-13,16H,6,14-15H2,1-5H3,(H,29,33)(H,30,35)/b21-12+ |
| InChIKey | AXMZQINTDWUMMT-CIAFOILYSA-N |
| XLogP | 4.48 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|