C28H33ClN4O3 — CID 132681348
N-(4-chlorophenyl)-2-[(4Z)-2,5-dioxo-4-[(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylidene]imidazolidin-1-yl]acetamide (PubChem CID 132681348) has the molecular formula C28H33ClN4O3 and a molecular weight of 509.05 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(4Z)-2,5-dioxo-4-[(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylidene]imidazolidin-1-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(4Z)-2,5-dioxo-4-[(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylidene]imidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 132681348 |
| Molecular Formula | C28H33ClN4O3 |
| Molecular Weight | 509.05 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(4Z)-2,5-dioxo-4-[(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylidene]imidazolidin-1-yl]acetamide |
| SMILES | Cc1cc2c(cc1/C=C1\NC(=O)N(CC(=O)Nc3ccc(Cl)cc3)C1=O)C(C)CC(C)(C)N2C(C)C |
| InChI | InChI=1S/C28H33ClN4O3/c1-16(2)33-24-11-17(3)19(12-22(24)18(4)14-28(33,5)6)13-23-26(35)32(27(36)31-23)15-25(34)30-21-9-7-20(29)8-10-21/h7-13,16,18H,14-15H2,1-6H3,(H,30,34)(H,31,36)/b23-13- |
| InChIKey | MUKNCDUGMABIBH-QRVIBDJDSA-N |
| XLogP | 5.68 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.05 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|