C26H29FN4O3 — CID 50859528
2-[(4E)-4-[(7-fluoro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methylphenyl)acetamide (PubChem CID 50859528) has the molecular formula C26H29FN4O3 and a molecular weight of 464.54 g/mol. Its IUPAC name is 2-[(4E)-4-[(7-fluoro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[(7-fluoro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 50859528 |
| Molecular Formula | C26H29FN4O3 |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 2-[(4E)-4-[(7-fluoro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)CN1C(=O)N/C(=C/c2cc3c(cc2F)N(C)C(C)(C)CC3C)C1=O |
| InChI | InChI=1S/C26H29FN4O3/c1-15-8-6-7-9-20(15)28-23(32)14-31-24(33)21(29-25(31)34)11-17-10-18-16(2)13-26(3,4)30(5)22(18)12-19(17)27/h6-12,16H,13-14H2,1-5H3,(H,28,32)(H,29,34)/b21-11+ |
| InChIKey | ZBRWXSRFSWAJGM-SRZZPIQSSA-N |
| XLogP | 4.39 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|