C29H35N3O3S — CID 50862769
2-[(5E)-2,4-dioxo-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide (PubChem CID 50862769) has the molecular formula C29H35N3O3S and a molecular weight of 505.68 g/mol. Its IUPAC name is 2-[(5E)-2,4-dioxo-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[(5E)-2,4-dioxo-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 50862769 |
| Molecular Formula | C29H35N3O3S |
| Molecular Weight | 505.68 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 2-[(5E)-2,4-dioxo-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide |
| SMILES | CCCN1c2cc(C)c(/C=C3/SC(=O)N(CC(=O)Nc4ccccc4C)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C29H35N3O3S/c1-7-12-32-24-13-19(3)21(14-22(24)20(4)16-29(32,5)6)15-25-27(34)31(28(35)36-25)17-26(33)30-23-11-9-8-10-18(23)2/h8-11,13-15,20H,7,12,16-17H2,1-6H3,(H,30,33)/b25-15+ |
| InChIKey | LIWBPYIXTQGVSL-MFKUBSTISA-N |
| XLogP | 6.48 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.68 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|