C28H32ClN3O3S — CID 50861393
2-[(5E)-5-[(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3,4-dimethylphenyl)acetamide (PubChem CID 50861393) has the molecular formula C28H32ClN3O3S and a molecular weight of 526.10 g/mol. Its IUPAC name is 2-[(5E)-5-[(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 50861393 |
| Molecular Formula | C28H32ClN3O3S |
| Molecular Weight | 526.10 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 2-[(5E)-5-[(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3,4-dimethylphenyl)acetamide |
| SMILES | CCN1c2cc(Cl)c(/C=C3/SC(=O)N(CC(=O)Nc4ccc(C)c(C)c4)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C28H32ClN3O3S/c1-7-32-23-13-22(29)19(11-21(23)18(4)14-28(32,5)6)12-24-26(34)31(27(35)36-24)15-25(33)30-20-9-8-16(2)17(3)10-20/h8-13,18H,7,14-15H2,1-6H3,(H,30,33)/b24-12+ |
| InChIKey | SJZZTKNFPQSXSU-WYMPLXKRSA-N |
| XLogP | 6.74 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.10 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|