C24H34N2O2S — CID 50862730
(5Z)-3-butan-2-yl-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 50862730) has the molecular formula C24H34N2O2S and a molecular weight of 414.62 g/mol. Its IUPAC name is (5Z)-3-butan-2-yl-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-butan-2-yl-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 50862730 |
| Molecular Formula | C24H34N2O2S |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | (5Z)-3-butan-2-yl-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCN1c2cc(C)c(/C=C3\SC(=O)N(C(C)CC)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C24H34N2O2S/c1-8-10-25-20-11-15(3)18(12-19(20)16(4)14-24(25,6)7)13-21-22(27)26(17(5)9-2)23(28)29-21/h11-13,16-17H,8-10,14H2,1-7H3/b21-13- |
| InChIKey | ORLVBEDWSBVMBT-BKUYFWCQSA-N |
| XLogP | 6.33 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|