C24H25Cl2N3OS — CID 136831730
(5Z)-2-(2,3-dichlorophenyl)imino-5-[[(4R)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 136831730) has the molecular formula C24H25Cl2N3OS and a molecular weight of 474.46 g/mol. Its IUPAC name is (5Z)-2-(2,3-dichlorophenyl)imino-5-[[(4R)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(2,3-dichlorophenyl)imino-5-[[(4R)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136831730 |
| Molecular Formula | C24H25Cl2N3OS |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | (5Z)-2-(2,3-dichlorophenyl)imino-5-[[(4R)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1cc2c(cc1/C=C1\S/C(=N/c3cccc(Cl)c3Cl)NC1=O)[C@H](C)CC(C)(C)N2C |
| InChI | InChI=1S/C24H25Cl2N3OS/c1-13-9-19-16(14(2)12-24(3,4)29(19)5)10-15(13)11-20-22(30)28-23(31-20)27-18-8-6-7-17(25)21(18)26/h6-11,14H,12H2,1-5H3,(H,27,28,30)/b20-11-/t14-/m1/s1 |
| InChIKey | VUDBCNLXVHBKRV-LPKQHDGYSA-N |
| XLogP | 6.92 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|