C27H32ClN3OS — CID 136831891
(5Z)-2-(3-chloro-2-methylphenyl)imino-5-[[(4S)-2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 136831891) has the molecular formula C27H32ClN3OS and a molecular weight of 482.09 g/mol. Its IUPAC name is (5Z)-2-(3-chloro-2-methylphenyl)imino-5-[[(4S)-2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(3-chloro-2-methylphenyl)imino-5-[[(4S)-2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136831891 |
| Molecular Formula | C27H32ClN3OS |
| Molecular Weight | 482.09 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | (5Z)-2-(3-chloro-2-methylphenyl)imino-5-[[(4S)-2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1cc2c(cc1/C=C1\S/C(=N/c3cccc(Cl)c3C)NC1=O)[C@@H](C)CC(C)(C)N2C(C)C |
| InChI | InChI=1S/C27H32ClN3OS/c1-15(2)31-23-11-16(3)19(12-20(23)17(4)14-27(31,6)7)13-24-25(32)30-26(33-24)29-22-10-8-9-21(28)18(22)5/h8-13,15,17H,14H2,1-7H3,(H,29,30,32)/b24-13-/t17-/m0/s1 |
| InChIKey | VHQWHWKOWALOKF-GHRPQRKGSA-N |
| XLogP | 7.35 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.09 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|