C26H31N3OS — CID 136827282
(5Z)-2-(2-methylphenyl)imino-5-[[(4R)-2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 136827282) has the molecular formula C26H31N3OS and a molecular weight of 433.62 g/mol. Its IUPAC name is (5Z)-2-(2-methylphenyl)imino-5-[[(4R)-2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(2-methylphenyl)imino-5-[[(4R)-2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136827282 |
| Molecular Formula | C26H31N3OS |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | (5Z)-2-(2-methylphenyl)imino-5-[[(4R)-2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccccc1/N=C1\NC(=O)/C(=C/c2ccc3c(c2)[C@H](C)CC(C)(C)N3C(C)C)S1 |
| InChI | InChI=1S/C26H31N3OS/c1-16(2)29-22-12-11-19(13-20(22)18(4)15-26(29,5)6)14-23-24(30)28-25(31-23)27-21-10-8-7-9-17(21)3/h7-14,16,18H,15H2,1-6H3,(H,27,28,30)/b23-14-/t18-/m1/s1 |
| InChIKey | GREIVKAMMQOPIW-NLKUQUHMSA-N |
| XLogP | 6.39 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|