C24H26ClN3OS — CID 136831710
(5Z)-2-(5-chloro-2-methylphenyl)imino-5-[[(4S)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 136831710) has the molecular formula C24H26ClN3OS and a molecular weight of 440.01 g/mol. Its IUPAC name is (5Z)-2-(5-chloro-2-methylphenyl)imino-5-[[(4S)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(5-chloro-2-methylphenyl)imino-5-[[(4S)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136831710 |
| Molecular Formula | C24H26ClN3OS |
| Molecular Weight | 440.01 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | (5Z)-2-(5-chloro-2-methylphenyl)imino-5-[[(4S)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(Cl)cc1/N=C1\NC(=O)/C(=C/c2ccc3c(c2)[C@@H](C)CC(C)(C)N3C)S1 |
| InChI | InChI=1S/C24H26ClN3OS/c1-14-6-8-17(25)12-19(14)26-23-27-22(29)21(30-23)11-16-7-9-20-18(10-16)15(2)13-24(3,4)28(20)5/h6-12,15H,13H2,1-5H3,(H,26,27,29)/b21-11-/t15-/m0/s1 |
| InChIKey | JCPYAJWVKWQKRD-SYZMQFJCSA-N |
| XLogP | 6.26 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.01 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|