C25H28N2O2S — CID 132666373
(5Z)-3-phenyl-5-[(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 132666373) has the molecular formula C25H28N2O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is (5Z)-3-phenyl-5-[(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-phenyl-5-[(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 132666373 |
| Molecular Formula | C25H28N2O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | (5Z)-3-phenyl-5-[(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC1CC(C)(C)N(C(C)C)c2ccc(/C=C3\SC(=O)N(c4ccccc4)C3=O)cc21 |
| InChI | InChI=1S/C25H28N2O2S/c1-16(2)27-21-12-11-18(13-20(21)17(3)15-25(27,4)5)14-22-23(28)26(24(29)30-22)19-9-7-6-8-10-19/h6-14,16-17H,15H2,1-5H3/b22-14- |
| InChIKey | KHVLMFOIWLIRMF-HMAPJEAMSA-N |
| XLogP | 6.43 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|