C24H27N3OS — CID 50858154
(5E)-3-methyl-2-phenylimino-5-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 50858154) has the molecular formula C24H27N3OS and a molecular weight of 405.57 g/mol. Its IUPAC name is (5E)-3-methyl-2-phenylimino-5-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-methyl-2-phenylimino-5-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50858154 |
| Molecular Formula | C24H27N3OS |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | (5E)-3-methyl-2-phenylimino-5-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CC1CC(C)(C)N(C)c2ccc(/C=C3/S/C(=N\c4ccccc4)N(C)C3=O)cc21 |
| InChI | InChI=1S/C24H27N3OS/c1-16-15-24(2,3)27(5)20-12-11-17(13-19(16)20)14-21-22(28)26(4)23(29-21)25-18-9-7-6-8-10-18/h6-14,16H,15H2,1-5H3/b21-14+,25-23- |
| InChIKey | SGLWJVROOQOUTF-LISDSOCTSA-N |
| XLogP | 5.64 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|