C23H30N2O4S — CID 132668983
methyl 2-[(5E)-2,4-dioxo-5-[(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-3-yl]propanoate (PubChem CID 132668983) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is methyl 2-[(5E)-2,4-dioxo-5-[(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | methyl 2-[(5E)-2,4-dioxo-5-[(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 132668983 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | methyl 2-[(5E)-2,4-dioxo-5-[(2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-3-yl]propanoate |
| SMILES | COC(=O)C(C)N1C(=O)S/C(=C/c2ccc3c(c2)C(C)CC(C)(C)N3C(C)C)C1=O |
| InChI | InChI=1S/C23H30N2O4S/c1-13(2)25-18-9-8-16(10-17(18)14(3)12-23(25,5)6)11-19-20(26)24(22(28)30-19)15(4)21(27)29-7/h8-11,13-15H,12H2,1-7H3/b19-11+ |
| InChIKey | WYFHIGXBORDGHL-YBFXNURJSA-N |
| XLogP | 4.78 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|