C30H38N4O2S — CID 99885957
(5Z)-3-ethyl-2-(4-morpholin-4-ylphenyl)imino-5-[[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 99885957) has the molecular formula C30H38N4O2S and a molecular weight of 518.73 g/mol. Its IUPAC name is (5Z)-3-ethyl-2-(4-morpholin-4-ylphenyl)imino-5-[[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-ethyl-2-(4-morpholin-4-ylphenyl)imino-5-[[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 99885957 |
| Molecular Formula | C30H38N4O2S |
| Molecular Weight | 518.73 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | (5Z)-3-ethyl-2-(4-morpholin-4-ylphenyl)imino-5-[[(4S)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C/c2cc3c(cc2C)N(C)C(C)(C)C[C@@H]3C)S/C1=N/c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C30H38N4O2S/c1-7-34-28(35)27(18-22-17-25-21(3)19-30(4,5)32(6)26(25)16-20(22)2)37-29(34)31-23-8-10-24(11-9-23)33-12-14-36-15-13-33/h8-11,16-18,21H,7,12-15,19H2,1-6H3/b27-18-,31-29+/t21-/m0/s1 |
| InChIKey | BSWHVCJZTOXAHU-MHEOMTLHSA-N |
| XLogP | 6.18 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.73 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|