C31H33N3OS — CID 50858734
(5E)-3-benzyl-5-[(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 50858734) has the molecular formula C31H33N3OS and a molecular weight of 495.69 g/mol. Its IUPAC name is (5E)-3-benzyl-5-[(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-benzyl-5-[(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50858734 |
| Molecular Formula | C31H33N3OS |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | (5E)-3-benzyl-5-[(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | Cc1cc2c(cc1/C=C1/S/C(=N\c3ccccc3)N(Cc3ccccc3)C1=O)C(C)CC(C)(C)N2C |
| InChI | InChI=1S/C31H33N3OS/c1-21-16-27-26(22(2)19-31(3,4)33(27)5)17-24(21)18-28-29(35)34(20-23-12-8-6-9-13-23)30(36-28)32-25-14-10-7-11-15-25/h6-18,22H,19-20H2,1-5H3/b28-18+,32-30- |
| InChIKey | OZKLEZCNEHXGBE-VVCQNSFQSA-N |
| XLogP | 7.52 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|