C29H37N3O2S — CID 132678761
(5Z)-3-(2-methoxyethyl)-2-phenylimino-5-[(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 132678761) has the molecular formula C29H37N3O2S and a molecular weight of 491.70 g/mol. Its IUPAC name is (5Z)-3-(2-methoxyethyl)-2-phenylimino-5-[(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(2-methoxyethyl)-2-phenylimino-5-[(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 132678761 |
| Molecular Formula | C29H37N3O2S |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | (5Z)-3-(2-methoxyethyl)-2-phenylimino-5-[(2,2,4,7-tetramethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COCCN1C(=O)/C(=C/c2cc3c(cc2C)N(C(C)C)C(C)(C)CC3C)S/C1=N/c1ccccc1 |
| InChI | InChI=1S/C29H37N3O2S/c1-19(2)32-25-15-20(3)22(16-24(25)21(4)18-29(32,5)6)17-26-27(33)31(13-14-34-7)28(35-26)30-23-11-9-8-10-12-23/h8-12,15-17,19,21H,13-14,18H2,1-7H3/b26-17-,30-28+ |
| InChIKey | RKWLZPVQZZSTRV-PSRSWHCHSA-N |
| XLogP | 6.75 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|