C36H40N4OS — CID 50860977
(5E)-3-[2-(1H-indol-3-yl)ethyl]-2-phenylimino-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 50860977) has the molecular formula C36H40N4OS and a molecular weight of 576.81 g/mol. Its IUPAC name is (5E)-3-[2-(1H-indol-3-yl)ethyl]-2-phenylimino-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-[2-(1H-indol-3-yl)ethyl]-2-phenylimino-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50860977 |
| Molecular Formula | C36H40N4OS |
| Molecular Weight | 576.81 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | (5E)-3-[2-(1H-indol-3-yl)ethyl]-2-phenylimino-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCCN1c2cc(C)c(/C=C3/S/C(=N\c4ccccc4)N(CCc4c[nH]c5ccccc45)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C36H40N4OS/c1-6-17-40-32-19-24(2)27(20-30(32)25(3)22-36(40,4)5)21-33-34(41)39(35(42-33)38-28-12-8-7-9-13-28)18-16-26-23-37-31-15-11-10-14-29(26)31/h7-15,19-21,23,25,37H,6,16-18,22H2,1-5H3/b33-21+,38-35- |
| InChIKey | SMXVPYKLITZYPH-FZZREKNSSA-N |
| XLogP | 8.83 |
| TPSA | 51.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.81 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|