C34H34N4OS — CID 50864875
(5E)-3-[2-(1H-indol-3-yl)ethyl]-5-[(1,2,2,4,7-pentamethylquinolin-6-yl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 50864875) has the molecular formula C34H34N4OS and a molecular weight of 546.74 g/mol. Its IUPAC name is (5E)-3-[2-(1H-indol-3-yl)ethyl]-5-[(1,2,2,4,7-pentamethylquinolin-6-yl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-[2-(1H-indol-3-yl)ethyl]-5-[(1,2,2,4,7-pentamethylquinolin-6-yl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50864875 |
| Molecular Formula | C34H34N4OS |
| Molecular Weight | 546.74 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | (5E)-3-[2-(1H-indol-3-yl)ethyl]-5-[(1,2,2,4,7-pentamethylquinolin-6-yl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | CC1=CC(C)(C)N(C)c2cc(C)c(/C=C3/S/C(=N\c4ccccc4)N(CCc4c[nH]c5ccccc45)C3=O)cc21 |
| InChI | InChI=1S/C34H34N4OS/c1-22-17-30-28(23(2)20-34(3,4)37(30)5)18-25(22)19-31-32(39)38(33(40-31)36-26-11-7-6-8-12-26)16-15-24-21-35-29-14-10-9-13-27(24)29/h6-14,17-21,35H,15-16H2,1-5H3/b31-19+,36-33- |
| InChIKey | CXUVESXLNHFVOV-YBHHBBJGSA-N |
| XLogP | 7.95 |
| TPSA | 51.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.74 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|