C31H30ClN3OS — CID 50865208
(5E)-5-[(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]-3-(2-phenylethyl)-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 50865208) has the molecular formula C31H30ClN3OS and a molecular weight of 528.12 g/mol. Its IUPAC name is (5E)-5-[(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]-3-(2-phenylethyl)-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]-3-(2-phenylethyl)-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50865208 |
| Molecular Formula | C31H30ClN3OS |
| Molecular Weight | 528.12 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | (5E)-5-[(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]-3-(2-phenylethyl)-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | CC1=CC(C)(C)N(C)c2cc(Cl)c(/C=C3/S/C(=N\c4ccccc4)N(CCc4ccccc4)C3=O)cc21 |
| InChI | InChI=1S/C31H30ClN3OS/c1-21-20-31(2,3)34(4)27-19-26(32)23(17-25(21)27)18-28-29(36)35(16-15-22-11-7-5-8-12-22)30(37-28)33-24-13-9-6-10-14-24/h5-14,17-20H,15-16H2,1-4H3/b28-18+,33-30- |
| InChIKey | ZWSAJCBQDJDUGT-WMGVAAGXSA-N |
| XLogP | 7.82 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.12 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|