C31H31N3OS — CID 50864356
(5E)-3-(2-phenylethyl)-2-phenylimino-5-[(1,2,2,4-tetramethylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 50864356) has the molecular formula C31H31N3OS and a molecular weight of 493.68 g/mol. Its IUPAC name is (5E)-3-(2-phenylethyl)-2-phenylimino-5-[(1,2,2,4-tetramethylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(2-phenylethyl)-2-phenylimino-5-[(1,2,2,4-tetramethylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50864356 |
| Molecular Formula | C31H31N3OS |
| Molecular Weight | 493.68 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | (5E)-3-(2-phenylethyl)-2-phenylimino-5-[(1,2,2,4-tetramethylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CC1=CC(C)(C)N(C)c2ccc(/C=C3/S/C(=N\c4ccccc4)N(CCc4ccccc4)C3=O)cc21 |
| InChI | InChI=1S/C31H31N3OS/c1-22-21-31(2,3)33(4)27-16-15-24(19-26(22)27)20-28-29(35)34(18-17-23-11-7-5-8-12-23)30(36-28)32-25-13-9-6-10-14-25/h5-16,19-21H,17-18H2,1-4H3/b28-20+,32-30- |
| InChIKey | MLGJOPPFAWEPTH-CXLLQUDUSA-N |
| XLogP | 7.16 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.68 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|