C28H33N3OS — CID 50868055
(5E)-2-phenylimino-3-propyl-5-[(2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 50868055) has the molecular formula C28H33N3OS and a molecular weight of 459.66 g/mol. Its IUPAC name is (5E)-2-phenylimino-3-propyl-5-[(2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-phenylimino-3-propyl-5-[(2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50868055 |
| Molecular Formula | C28H33N3OS |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | (5E)-2-phenylimino-3-propyl-5-[(2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCCN1C(=O)/C(=C\c2ccc3c(c2)C(C)=CC(C)(C)N3CCC)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C28H33N3OS/c1-6-15-30-26(32)25(33-27(30)29-22-11-9-8-10-12-22)18-21-13-14-24-23(17-21)20(3)19-28(4,5)31(24)16-7-2/h8-14,17-19H,6-7,15-16H2,1-5H3/b25-18+,29-27- |
| InChIKey | SXXYQDGWZTWWQF-BUWHHMLQSA-N |
| XLogP | 7.11 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|