C30H31N3O3S — CID 50866455
(5E)-5-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-3-(furan-2-ylmethyl)-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 50866455) has the molecular formula C30H31N3O3S and a molecular weight of 513.66 g/mol. Its IUPAC name is (5E)-5-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-3-(furan-2-ylmethyl)-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-3-(furan-2-ylmethyl)-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50866455 |
| Molecular Formula | C30H31N3O3S |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | (5E)-5-[(1-ethyl-2,2,4-trimethylquinolin-6-yl)methylidene]-3-(furan-2-ylmethyl)-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCN1c2ccc(/C=C3/S/C(=N\c4ccc(OC)cc4)N(Cc4ccco4)C3=O)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C30H31N3O3S/c1-6-33-26-14-9-21(16-25(26)20(2)18-30(33,3)4)17-27-28(34)32(19-24-8-7-15-36-24)29(37-27)31-22-10-12-23(35-5)13-11-22/h7-18H,6,19H2,1-5H3/b27-17+,31-29- |
| InChIKey | GNWDQTNYZOQGKS-CACIESLVSA-N |
| XLogP | 7.11 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|