C24H20N2O6S — CID 126113976
(5E)-3-(furan-2-ylmethyl)-5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 126113976) has the molecular formula C24H20N2O6S and a molecular weight of 464.50 g/mol. Its IUPAC name is (5E)-3-(furan-2-ylmethyl)-5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(furan-2-ylmethyl)-5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126113976 |
| Molecular Formula | C24H20N2O6S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | (5E)-3-(furan-2-ylmethyl)-5-[(6-methoxy-1,3-benzodioxol-5-yl)methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/N=C2\S/C(=C/c3cc4c(cc3OC)OCO4)C(=O)N2Cc2ccco2)cc1 |
| InChI | InChI=1S/C24H20N2O6S/c1-28-17-7-5-16(6-8-17)25-24-26(13-18-4-3-9-30-18)23(27)22(33-24)11-15-10-20-21(32-14-31-20)12-19(15)29-2/h3-12H,13-14H2,1-2H3/b22-11+,25-24- |
| InChIKey | STSJOJGEJMVXNN-LEHDYKMSSA-N |
| XLogP | 4.83 |
| TPSA | 82.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|