C27H24N4O3S — CID 126251995
(5Z)-5-[(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methylidene]-3-(furan-2-ylmethyl)-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 126251995) has the molecular formula C27H24N4O3S and a molecular weight of 484.58 g/mol. Its IUPAC name is (5Z)-5-[(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methylidene]-3-(furan-2-ylmethyl)-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methylidene]-3-(furan-2-ylmethyl)-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126251995 |
| Molecular Formula | C27H24N4O3S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | (5Z)-5-[(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methylidene]-3-(furan-2-ylmethyl)-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/N=C2/S/C(=C\c3cc(C)n(-c4ccccn4)c3C)C(=O)N2Cc2ccco2)cc1 |
| InChI | InChI=1S/C27H24N4O3S/c1-18-15-20(19(2)31(18)25-8-4-5-13-28-25)16-24-26(32)30(17-23-7-6-14-34-23)27(35-24)29-21-9-11-22(33-3)12-10-21/h4-16H,17H2,1-3H3/b24-16-,29-27+ |
| InChIKey | ZJBJINWPDIHKEN-OLCXPRTASA-N |
| XLogP | 5.89 |
| TPSA | 72.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|