C24H23FN4OS — CID 126248287
(5E)-5-[[2,5-dimethyl-1-(4-methyl-2-pyridinyl)pyrrol-3-yl]methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 126248287) has the molecular formula C24H23FN4OS and a molecular weight of 434.54 g/mol. Its IUPAC name is (5E)-5-[[2,5-dimethyl-1-(4-methyl-2-pyridinyl)pyrrol-3-yl]methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[2,5-dimethyl-1-(4-methyl-2-pyridinyl)pyrrol-3-yl]methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126248287 |
| Molecular Formula | C24H23FN4OS |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | (5E)-5-[[2,5-dimethyl-1-(4-methyl-2-pyridinyl)pyrrol-3-yl]methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2cc(C)n(-c3cc(C)ccn3)c2C)S/C1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C24H23FN4OS/c1-5-28-23(30)21(31-24(28)27-20-8-6-19(25)7-9-20)14-18-13-16(3)29(17(18)4)22-12-15(2)10-11-26-22/h6-14H,5H2,1-4H3/b21-14+,27-24- |
| InChIKey | LXKWHEIMIYBJNZ-ZDGMEELJSA-N |
| XLogP | 5.56 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|