C25H24FN3OS — CID 126227374
(5E)-5-[(1-benzyl-2,5-dimethylpyrrol-3-yl)methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 126227374) has the molecular formula C25H24FN3OS and a molecular weight of 433.55 g/mol. Its IUPAC name is (5E)-5-[(1-benzyl-2,5-dimethylpyrrol-3-yl)methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(1-benzyl-2,5-dimethylpyrrol-3-yl)methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126227374 |
| Molecular Formula | C25H24FN3OS |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | (5E)-5-[(1-benzyl-2,5-dimethylpyrrol-3-yl)methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2cc(C)n(Cc3ccccc3)c2C)S/C1=N/c1ccc(F)cc1 |
| InChI | InChI=1S/C25H24FN3OS/c1-4-28-24(30)23(31-25(28)27-22-12-10-21(26)11-13-22)15-20-14-17(2)29(18(20)3)16-19-8-6-5-7-9-19/h5-15H,4,16H2,1-3H3/b23-15+,27-25+ |
| InChIKey | LYVKSMVARMTZGZ-VCICBFQVSA-N |
| XLogP | 5.92 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|