C24H19FN2OS — CID 126244957
(5E)-3-ethyl-2-(4-fluorophenyl)imino-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 126244957) has the molecular formula C24H19FN2OS and a molecular weight of 402.49 g/mol. Its IUPAC name is (5E)-3-ethyl-2-(4-fluorophenyl)imino-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-ethyl-2-(4-fluorophenyl)imino-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126244957 |
| Molecular Formula | C24H19FN2OS |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | (5E)-3-ethyl-2-(4-fluorophenyl)imino-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2ccc(-c3ccccc3)cc2)S/C1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C24H19FN2OS/c1-2-27-23(28)22(29-24(27)26-21-14-12-20(25)13-15-21)16-17-8-10-19(11-9-17)18-6-4-3-5-7-18/h3-16H,2H2,1H3/b22-16+,26-24- |
| InChIKey | NSMILQVXNUBYKK-IPLYMLRXSA-N |
| XLogP | 6.12 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|