C26H26N4O2S — CID 126251259
(5Z)-5-[(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 126251259) has the molecular formula C26H26N4O2S and a molecular weight of 458.59 g/mol. Its IUPAC name is (5Z)-5-[(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126251259 |
| Molecular Formula | C26H26N4O2S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (5Z)-5-[(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(/C=C2\S/C(=N\c3ccccc3)N(C[C@H]3CCCO3)C2=O)c(C)n1-c1ccccn1 |
| InChI | InChI=1S/C26H26N4O2S/c1-18-15-20(19(2)30(18)24-12-6-7-13-27-24)16-23-25(31)29(17-22-11-8-14-32-22)26(33-23)28-21-9-4-3-5-10-21/h3-7,9-10,12-13,15-16,22H,8,11,14,17H2,1-2H3/b23-16-,28-26-/t22-/m1/s1 |
| InChIKey | NBQYFZCUTBXKBX-IMHHSZBNSA-N |
| XLogP | 5.27 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|