C27H23ClN2O2S2 — CID 6370947
(5E)-5-[[4-(4-chlorophenyl)sulfanylphenyl]methylidene]-3-(oxolan-2-ylmethyl)-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 6370947) has the molecular formula C27H23ClN2O2S2 and a molecular weight of 507.08 g/mol. Its IUPAC name is (5E)-5-[[4-(4-chlorophenyl)sulfanylphenyl]methylidene]-3-(oxolan-2-ylmethyl)-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[4-(4-chlorophenyl)sulfanylphenyl]methylidene]-3-(oxolan-2-ylmethyl)-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6370947 |
| Molecular Formula | C27H23ClN2O2S2 |
| Molecular Weight | 507.08 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | (5E)-5-[[4-(4-chlorophenyl)sulfanylphenyl]methylidene]-3-(oxolan-2-ylmethyl)-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccc(Sc3ccc(Cl)cc3)cc2)S/C(=N\c2ccccc2)N1CC1CCCO1 |
| InChI | InChI=1S/C27H23ClN2O2S2/c28-20-10-14-24(15-11-20)33-23-12-8-19(9-13-23)17-25-26(31)30(18-22-7-4-16-32-22)27(34-25)29-21-5-2-1-3-6-21/h1-3,5-6,8-15,17,22H,4,7,16,18H2/b25-17+,29-27- |
| InChIKey | JCWAXPRFROFAAD-XJBRANNNSA-N |
| XLogP | 7.27 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.08 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|