C26H23ClN2O2S2 — CID 126103499
(5Z)-5-[[4-(4-chlorophenyl)sulfanylphenyl]methylidene]-3-(2-ethoxyethyl)-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 126103499) has the molecular formula C26H23ClN2O2S2 and a molecular weight of 495.07 g/mol. Its IUPAC name is (5Z)-5-[[4-(4-chlorophenyl)sulfanylphenyl]methylidene]-3-(2-ethoxyethyl)-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-(4-chlorophenyl)sulfanylphenyl]methylidene]-3-(2-ethoxyethyl)-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126103499 |
| Molecular Formula | C26H23ClN2O2S2 |
| Molecular Weight | 495.07 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | (5Z)-5-[[4-(4-chlorophenyl)sulfanylphenyl]methylidene]-3-(2-ethoxyethyl)-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | CCOCCN1C(=O)/C(=C/c2ccc(Sc3ccc(Cl)cc3)cc2)S/C1=N/c1ccccc1 |
| InChI | InChI=1S/C26H23ClN2O2S2/c1-2-31-17-16-29-25(30)24(33-26(29)28-21-6-4-3-5-7-21)18-19-8-12-22(13-9-19)32-23-14-10-20(27)11-15-23/h3-15,18H,2,16-17H2,1H3/b24-18-,28-26+ |
| InChIKey | FYCNFCKECQCOTO-UHXJNLQPSA-N |
| XLogP | 7.13 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.07 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|