C26H24N2O2S2 — CID 126235077
(5Z)-3-(2-methoxyethyl)-5-[[4-(4-methylphenyl)sulfanylphenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 126235077) has the molecular formula C26H24N2O2S2 and a molecular weight of 460.62 g/mol. Its IUPAC name is (5Z)-3-(2-methoxyethyl)-5-[[4-(4-methylphenyl)sulfanylphenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(2-methoxyethyl)-5-[[4-(4-methylphenyl)sulfanylphenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126235077 |
| Molecular Formula | C26H24N2O2S2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | (5Z)-3-(2-methoxyethyl)-5-[[4-(4-methylphenyl)sulfanylphenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | COCCN1C(=O)/C(=C/c2ccc(Sc3ccc(C)cc3)cc2)S/C1=N/c1ccccc1 |
| InChI | InChI=1S/C26H24N2O2S2/c1-19-8-12-22(13-9-19)31-23-14-10-20(11-15-23)18-24-25(29)28(16-17-30-2)26(32-24)27-21-6-4-3-5-7-21/h3-15,18H,16-17H2,1-2H3/b24-18-,27-26+ |
| InChIKey | GPWANZDPPNMNCF-BDMFQALQSA-N |
| XLogP | 6.40 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|